C34H48N2O4 — CID 139938732
2-amino-5-[2-(4-amino-2,5-ditert-butyl-3-hydroxyphenoxy)phenoxy]-3,6-ditert-butylphenol (PubChem CID 139938732) has the molecular formula C34H48N2O4 and a molecular weight of 548.77 g/mol. Its IUPAC name is 2-amino-5-[2-(4-amino-2,5-ditert-butyl-3-hydroxyphenoxy)phenoxy]-3,6-ditert-butylphenol.
| Compound Name | 2-amino-5-[2-(4-amino-2,5-ditert-butyl-3-hydroxyphenoxy)phenoxy]-3,6-ditert-butylphenol |
|---|---|
| PubChem CID | 139938732 |
| Molecular Formula | C34H48N2O4 |
| Molecular Weight | 548.77 g/mol |
| Exact Mass | 548.36 |
| IUPAC Name | 2-amino-5-[2-(4-amino-2,5-ditert-butyl-3-hydroxyphenoxy)phenoxy]-3,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(Oc2ccccc2Oc2cc(C(C)(C)C)c(N)c(O)c2C(C)(C)C)c(C(C)(C)C)c(O)c1N |
| InChI | InChI=1S/C34H48N2O4/c1-31(2,3)19-17-23(25(33(7,8)9)29(37)27(19)35)39-21-15-13-14-16-22(21)40-24-18-20(32(4,5)6)28(36)30(38)26(24)34(10,11)12/h13-18,37-38H,35-36H2,1-12H3 |
| InChIKey | DIYASZLKJJWSET-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.77 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|