C14H23NO — CID 126738766
5-amino-2,3-ditert-butylphenol (PubChem CID 126738766) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 5-amino-2,3-ditert-butylphenol.
| Compound Name | 5-amino-2,3-ditert-butylphenol |
|---|---|
| PubChem CID | 126738766 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 5-amino-2,3-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(N)cc(O)c1C(C)(C)C |
| InChI | InChI=1S/C14H23NO/c1-13(2,3)10-7-9(15)8-11(16)12(10)14(4,5)6/h7-8,16H,15H2,1-6H3 |
| InChIKey | VKZIUIOFYZGAJG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|