C14H14F3N — CID 172514436
4-tert-butyl-5,6,7-trifluoronaphthalen-2-amine (PubChem CID 172514436) has the molecular formula C14H14F3N and a molecular weight of 253.27 g/mol. Its IUPAC name is 4-tert-butyl-5,6,7-trifluoronaphthalen-2-amine.
| Compound Name | 4-tert-butyl-5,6,7-trifluoronaphthalen-2-amine |
|---|---|
| PubChem CID | 172514436 |
| Molecular Formula | C14H14F3N |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 4-tert-butyl-5,6,7-trifluoronaphthalen-2-amine |
| SMILES | CC(C)(C)c1cc(N)cc2cc(F)c(F)c(F)c12 |
| InChI | InChI=1S/C14H14F3N/c1-14(2,3)9-6-8(18)4-7-5-10(15)12(16)13(17)11(7)9/h4-6H,18H2,1-3H3 |
| InChIKey | UBIBQCFAEOPIFG-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|