C18H24F2N2 — CID 178101398
6-amino-2,3-difluoro-8-propan-2-ylnaphthalene-1-carbonitrile;ethane (PubChem CID 178101398) has the molecular formula C18H24F2N2 and a molecular weight of 306.40 g/mol. Its IUPAC name is 6-amino-2,3-difluoro-8-propan-2-ylnaphthalene-1-carbonitrile;ethane.
| Compound Name | 6-amino-2,3-difluoro-8-propan-2-ylnaphthalene-1-carbonitrile;ethane |
|---|---|
| PubChem CID | 178101398 |
| Molecular Formula | C18H24F2N2 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 6-amino-2,3-difluoro-8-propan-2-ylnaphthalene-1-carbonitrile;ethane |
| SMILES | CC.CC.CC(C)c1cc(N)cc2cc(F)c(F)c(C#N)c12 |
| InChI | InChI=1S/C14H12F2N2.2C2H6/c1-7(2)10-5-9(18)3-8-4-12(15)14(16)11(6-17)13(8)10;2*1-2/h3-5,7H,18H2,1-2H3;2*1-2H3 |
| InChIKey | BGIRRLBZOAODSQ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|