C19H25F2N — CID 176951360
ethane;5-ethynyl-6,7-difluoro-4-propan-2-ylnaphthalen-2-amine (PubChem CID 176951360) has the molecular formula C19H25F2N and a molecular weight of 305.41 g/mol. Its IUPAC name is ethane;5-ethynyl-6,7-difluoro-4-propan-2-ylnaphthalen-2-amine.
| Compound Name | ethane;5-ethynyl-6,7-difluoro-4-propan-2-ylnaphthalen-2-amine |
|---|---|
| PubChem CID | 176951360 |
| Molecular Formula | C19H25F2N |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | ethane;5-ethynyl-6,7-difluoro-4-propan-2-ylnaphthalen-2-amine |
| SMILES | C#Cc1c(F)c(F)cc2cc(N)cc(C(C)C)c12.CC.CC |
| InChI | InChI=1S/C15H13F2N.2C2H6/c1-4-11-14-9(6-13(16)15(11)17)5-10(18)7-12(14)8(2)3;2*1-2/h1,5-8H,18H2,2-3H3;2*1-2H3 |
| InChIKey | RHJFWHOCLPGCCT-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|