C13H13F2N3 — CID 176951041
ethane;5-ethynyl-6,7-difluoro-4-methyl-1,8-naphthyridin-2-amine (PubChem CID 176951041) has the molecular formula C13H13F2N3 and a molecular weight of 249.26 g/mol. Its IUPAC name is ethane;5-ethynyl-6,7-difluoro-4-methyl-1,8-naphthyridin-2-amine.
| Compound Name | ethane;5-ethynyl-6,7-difluoro-4-methyl-1,8-naphthyridin-2-amine |
|---|---|
| PubChem CID | 176951041 |
| Molecular Formula | C13H13F2N3 |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | ethane;5-ethynyl-6,7-difluoro-4-methyl-1,8-naphthyridin-2-amine |
| SMILES | C#Cc1c(F)c(F)nc2nc(N)cc(C)c12.CC |
| InChI | InChI=1S/C11H7F2N3.C2H6/c1-3-6-8-5(2)4-7(14)15-11(8)16-10(13)9(6)12;1-2/h1,4H,2H3,(H2,14,15,16);1-2H3 |
| InChIKey | FIGAXEQQGMTKQQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|