C5H3F2IN2 — CID 159819691
5,6-difluoro-4-iodopyridin-2-amine (PubChem CID 159819691) has the molecular formula C5H3F2IN2 and a molecular weight of 255.99 g/mol. Its IUPAC name is 5,6-difluoro-4-iodopyridin-2-amine.
| Compound Name | 5,6-difluoro-4-iodopyridin-2-amine |
|---|---|
| PubChem CID | 159819691 |
| Molecular Formula | C5H3F2IN2 |
| Molecular Weight | 255.99 g/mol |
| Exact Mass | 255.93 |
| IUPAC Name | 5,6-difluoro-4-iodopyridin-2-amine |
| SMILES | Nc1cc(I)c(F)c(F)n1 |
| InChI | InChI=1S/C5H3F2IN2/c6-4-2(8)1-3(9)10-5(4)7/h1H,(H2,9,10) |
| InChIKey | NBTHDBBMKASBKT-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.99 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|