C10H9F — CID 106882406
2-ethynyl-1-fluoro-3,5-dimethylbenzene (PubChem CID 106882406) has the molecular formula C10H9F and a molecular weight of 148.18 g/mol. Its IUPAC name is 2-ethynyl-1-fluoro-3,5-dimethylbenzene.
| Compound Name | 2-ethynyl-1-fluoro-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 106882406 |
| Molecular Formula | C10H9F |
| Molecular Weight | 148.18 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 2-ethynyl-1-fluoro-3,5-dimethylbenzene |
| SMILES | C#Cc1c(C)cc(C)cc1F |
| InChI | InChI=1S/C10H9F/c1-4-9-8(3)5-7(2)6-10(9)11/h1,5-6H,2-3H3 |
| InChIKey | BSNYTACYIHVMFT-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.18 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|