C21H20F2 — CID 21359850
2-[2-(2,6-difluoro-4-methylphenyl)ethynyl]-1,3-dimethyl-5-(2-methylcyclopropyl)benzene (PubChem CID 21359850) has the molecular formula C21H20F2 and a molecular weight of 310.39 g/mol. Its IUPAC name is 2-[2-(2,6-difluoro-4-methylphenyl)ethynyl]-1,3-dimethyl-5-(2-methylcyclopropyl)benzene.
| Compound Name | 2-[2-(2,6-difluoro-4-methylphenyl)ethynyl]-1,3-dimethyl-5-(2-methylcyclopropyl)benzene |
|---|---|
| PubChem CID | 21359850 |
| Molecular Formula | C21H20F2 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 2-[2-(2,6-difluoro-4-methylphenyl)ethynyl]-1,3-dimethyl-5-(2-methylcyclopropyl)benzene |
| SMILES | Cc1cc(F)c(C#Cc2c(C)cc(C3CC3C)cc2C)c(F)c1 |
| InChI | InChI=1S/C21H20F2/c1-12-7-20(22)18(21(23)8-12)6-5-17-13(2)9-16(10-14(17)3)19-11-15(19)4/h7-10,15,19H,11H2,1-4H3 |
| InChIKey | ZWOUVNUQZIKZMQ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|