C12H14FN — CID 106882145
3-(2-fluoro-4,6-dimethylphenyl)-N-methylprop-2-yn-1-amine (PubChem CID 106882145) has the molecular formula C12H14FN and a molecular weight of 191.25 g/mol. Its IUPAC name is 3-(2-fluoro-4,6-dimethylphenyl)-N-methylprop-2-yn-1-amine.
| Compound Name | 3-(2-fluoro-4,6-dimethylphenyl)-N-methylprop-2-yn-1-amine |
|---|---|
| PubChem CID | 106882145 |
| Molecular Formula | C12H14FN |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 3-(2-fluoro-4,6-dimethylphenyl)-N-methylprop-2-yn-1-amine |
| SMILES | CNCC#Cc1c(C)cc(C)cc1F |
| InChI | InChI=1S/C12H14FN/c1-9-7-10(2)11(12(13)8-9)5-4-6-14-3/h7-8,14H,6H2,1-3H3 |
| InChIKey | BLIZJQUAPNVGFZ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|