C11H9F4N — CID 107289500
3-[3-fluoro-4-(trifluoromethyl)phenyl]-N-methylprop-2-yn-1-amine (PubChem CID 107289500) has the molecular formula C11H9F4N and a molecular weight of 231.19 g/mol. Its IUPAC name is 3-[3-fluoro-4-(trifluoromethyl)phenyl]-N-methylprop-2-yn-1-amine.
| Compound Name | 3-[3-fluoro-4-(trifluoromethyl)phenyl]-N-methylprop-2-yn-1-amine |
|---|---|
| PubChem CID | 107289500 |
| Molecular Formula | C11H9F4N |
| Molecular Weight | 231.19 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 3-[3-fluoro-4-(trifluoromethyl)phenyl]-N-methylprop-2-yn-1-amine |
| SMILES | CNCC#Cc1ccc(C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C11H9F4N/c1-16-6-2-3-8-4-5-9(10(12)7-8)11(13,14)15/h4-5,7,16H,6H2,1H3 |
| InChIKey | RCZHSGYHNUYHSH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.19 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|