C26H20F4 — CID 22044552
2-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethynyl]-7-propyl-9,10-dihydrophenanthrene (PubChem CID 22044552) has the molecular formula C26H20F4 and a molecular weight of 408.44 g/mol. Its IUPAC name is 2-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethynyl]-7-propyl-9,10-dihydrophenanthrene.
| Compound Name | 2-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethynyl]-7-propyl-9,10-dihydrophenanthrene |
|---|---|
| PubChem CID | 22044552 |
| Molecular Formula | C26H20F4 |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 2-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethynyl]-7-propyl-9,10-dihydrophenanthrene |
| SMILES | CCCc1ccc2c(c1)CCc1cc(C#Cc3ccc(C(F)(F)F)c(F)c3)ccc1-2 |
| InChI | InChI=1S/C26H20F4/c1-2-3-17-6-11-22-20(14-17)9-10-21-15-18(7-12-23(21)22)4-5-19-8-13-24(25(27)16-19)26(28,29)30/h6-8,11-16H,2-3,9-10H2,1H3 |
| InChIKey | QQQMZSSMOAYDBT-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|