C31H25F5 — CID 139850494
1-fluoro-2-[3-fluoro-4-(trifluoromethyl)phenyl]-6-[2-(4-hexylphenyl)ethynyl]naphthalene (PubChem CID 139850494) has the molecular formula C31H25F5 and a molecular weight of 492.53 g/mol. Its IUPAC name is 1-fluoro-2-[3-fluoro-4-(trifluoromethyl)phenyl]-6-[2-(4-hexylphenyl)ethynyl]naphthalene.
| Compound Name | 1-fluoro-2-[3-fluoro-4-(trifluoromethyl)phenyl]-6-[2-(4-hexylphenyl)ethynyl]naphthalene |
|---|---|
| PubChem CID | 139850494 |
| Molecular Formula | C31H25F5 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 1-fluoro-2-[3-fluoro-4-(trifluoromethyl)phenyl]-6-[2-(4-hexylphenyl)ethynyl]naphthalene |
| SMILES | CCCCCCc1ccc(C#Cc2ccc3c(F)c(-c4ccc(C(F)(F)F)c(F)c4)ccc3c2)cc1 |
| InChI | InChI=1S/C31H25F5/c1-2-3-4-5-6-21-7-9-22(10-8-21)11-12-23-13-16-26-24(19-23)14-17-27(30(26)33)25-15-18-28(29(32)20-25)31(34,35)36/h7-10,13-20H,2-6H2,1H3 |
| InChIKey | OIYMPGOWSBVTTA-UHFFFAOYSA-N |
| XLogP | 9.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|