C28H21ClF2 — CID 139850668
6-[2-(4-butylphenyl)ethynyl]-2-(4-chloro-3-fluorophenyl)-1-fluoronaphthalene (PubChem CID 139850668) has the molecular formula C28H21ClF2 and a molecular weight of 430.93 g/mol. Its IUPAC name is 6-[2-(4-butylphenyl)ethynyl]-2-(4-chloro-3-fluorophenyl)-1-fluoronaphthalene.
| Compound Name | 6-[2-(4-butylphenyl)ethynyl]-2-(4-chloro-3-fluorophenyl)-1-fluoronaphthalene |
|---|---|
| PubChem CID | 139850668 |
| Molecular Formula | C28H21ClF2 |
| Molecular Weight | 430.93 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 6-[2-(4-butylphenyl)ethynyl]-2-(4-chloro-3-fluorophenyl)-1-fluoronaphthalene |
| SMILES | CCCCc1ccc(C#Cc2ccc3c(F)c(-c4ccc(Cl)c(F)c4)ccc3c2)cc1 |
| InChI | InChI=1S/C28H21ClF2/c1-2-3-4-19-5-7-20(8-6-19)9-10-21-11-14-24-22(17-21)12-15-25(28(24)31)23-13-16-26(29)27(30)18-23/h5-8,11-18H,2-4H2,1H3 |
| InChIKey | GVKRQSOHKLQQRG-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.93 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|