C29H22F4 — CID 139850769
6-[2-(4-butylphenyl)ethynyl]-1-fluoro-2-[4-(trifluoromethyl)phenyl]naphthalene (PubChem CID 139850769) has the molecular formula C29H22F4 and a molecular weight of 446.49 g/mol. Its IUPAC name is 6-[2-(4-butylphenyl)ethynyl]-1-fluoro-2-[4-(trifluoromethyl)phenyl]naphthalene.
| Compound Name | 6-[2-(4-butylphenyl)ethynyl]-1-fluoro-2-[4-(trifluoromethyl)phenyl]naphthalene |
|---|---|
| PubChem CID | 139850769 |
| Molecular Formula | C29H22F4 |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 6-[2-(4-butylphenyl)ethynyl]-1-fluoro-2-[4-(trifluoromethyl)phenyl]naphthalene |
| SMILES | CCCCc1ccc(C#Cc2ccc3c(F)c(-c4ccc(C(F)(F)F)cc4)ccc3c2)cc1 |
| InChI | InChI=1S/C29H22F4/c1-2-3-4-20-5-7-21(8-6-20)9-10-22-11-17-27-24(19-22)14-18-26(28(27)30)23-12-15-25(16-13-23)29(31,32)33/h5-8,11-19H,2-4H2,1H3 |
| InChIKey | SIFDIJRSWYKNGV-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|