C32H27F5 — CID 139850550
1-fluoro-2-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethyl]-6-[2-(4-pentylphenyl)ethynyl]naphthalene (PubChem CID 139850550) has the molecular formula C32H27F5 and a molecular weight of 506.56 g/mol. Its IUPAC name is 1-fluoro-2-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethyl]-6-[2-(4-pentylphenyl)ethynyl]naphthalene.
| Compound Name | 1-fluoro-2-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethyl]-6-[2-(4-pentylphenyl)ethynyl]naphthalene |
|---|---|
| PubChem CID | 139850550 |
| Molecular Formula | C32H27F5 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | 1-fluoro-2-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethyl]-6-[2-(4-pentylphenyl)ethynyl]naphthalene |
| SMILES | CCCCCc1ccc(C#Cc2ccc3c(F)c(CCc4ccc(C(F)(F)F)c(F)c4)ccc3c2)cc1 |
| InChI | InChI=1S/C32H27F5/c1-2-3-4-5-22-6-8-23(9-7-22)10-11-24-13-18-28-27(20-24)17-16-26(31(28)34)15-12-25-14-19-29(30(33)21-25)32(35,36)37/h6-9,13-14,16-21H,2-5,12,15H2,1H3 |
| InChIKey | SAIZIMDCVVUDBU-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|