C30H22F6 — CID 139850766
2-[2-[3,5-difluoro-4-(trifluoromethyl)phenyl]ethyl]-1-fluoro-6-[2-(4-propylphenyl)ethynyl]naphthalene (PubChem CID 139850766) has the molecular formula C30H22F6 and a molecular weight of 496.49 g/mol. Its IUPAC name is 2-[2-[3,5-difluoro-4-(trifluoromethyl)phenyl]ethyl]-1-fluoro-6-[2-(4-propylphenyl)ethynyl]naphthalene.
| Compound Name | 2-[2-[3,5-difluoro-4-(trifluoromethyl)phenyl]ethyl]-1-fluoro-6-[2-(4-propylphenyl)ethynyl]naphthalene |
|---|---|
| PubChem CID | 139850766 |
| Molecular Formula | C30H22F6 |
| Molecular Weight | 496.49 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | 2-[2-[3,5-difluoro-4-(trifluoromethyl)phenyl]ethyl]-1-fluoro-6-[2-(4-propylphenyl)ethynyl]naphthalene |
| SMILES | CCCc1ccc(C#Cc2ccc3c(F)c(CCc4cc(F)c(C(F)(F)F)c(F)c4)ccc3c2)cc1 |
| InChI | InChI=1S/C30H22F6/c1-2-3-19-4-6-20(7-5-19)8-9-21-11-15-25-24(16-21)14-13-23(29(25)33)12-10-22-17-26(31)28(27(32)18-22)30(34,35)36/h4-7,11,13-18H,2-3,10,12H2,1H3 |
| InChIKey | DSULGKTYIWCZBV-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.49 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|