C28H22F6 — CID 139856614
1-fluoro-6-[2-fluoro-4-(2-fluoro-4-pentylphenyl)phenyl]-2-(trifluoromethyl)naphthalene (PubChem CID 139856614) has the molecular formula C28H22F6 and a molecular weight of 472.47 g/mol. Its IUPAC name is 1-fluoro-6-[2-fluoro-4-(2-fluoro-4-pentylphenyl)phenyl]-2-(trifluoromethyl)naphthalene.
| Compound Name | 1-fluoro-6-[2-fluoro-4-(2-fluoro-4-pentylphenyl)phenyl]-2-(trifluoromethyl)naphthalene |
|---|---|
| PubChem CID | 139856614 |
| Molecular Formula | C28H22F6 |
| Molecular Weight | 472.47 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 1-fluoro-6-[2-fluoro-4-(2-fluoro-4-pentylphenyl)phenyl]-2-(trifluoromethyl)naphthalene |
| SMILES | CCCCCc1ccc(-c2ccc(-c3ccc4c(F)c(C(F)(F)F)ccc4c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C28H22F6/c1-2-3-4-5-17-6-10-21(25(29)14-17)20-7-11-22(26(30)16-20)18-8-12-23-19(15-18)9-13-24(27(23)31)28(32,33)34/h6-16H,2-5H2,1H3 |
| InChIKey | SDNDKCLPWJYALR-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.47 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|