C22H19F5 — CID 139856344
1-fluoro-6-(2-fluoro-4-pentylphenyl)-2-(trifluoromethyl)naphthalene (PubChem CID 139856344) has the molecular formula C22H19F5 and a molecular weight of 378.38 g/mol. Its IUPAC name is 1-fluoro-6-(2-fluoro-4-pentylphenyl)-2-(trifluoromethyl)naphthalene.
| Compound Name | 1-fluoro-6-(2-fluoro-4-pentylphenyl)-2-(trifluoromethyl)naphthalene |
|---|---|
| PubChem CID | 139856344 |
| Molecular Formula | C22H19F5 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 1-fluoro-6-(2-fluoro-4-pentylphenyl)-2-(trifluoromethyl)naphthalene |
| SMILES | CCCCCc1ccc(-c2ccc3c(F)c(C(F)(F)F)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C22H19F5/c1-2-3-4-5-14-6-9-17(20(23)12-14)15-7-10-18-16(13-15)8-11-19(21(18)24)22(25,26)27/h6-13H,2-5H2,1H3 |
| InChIKey | WNDPEUFBQRLKKP-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|