C29H23F5 — CID 139855966
2-(2,2-difluoroethenyl)-1-fluoro-6-[2-fluoro-4-(2-fluoro-4-pentylphenyl)phenyl]naphthalene (PubChem CID 139855966) has the molecular formula C29H23F5 and a molecular weight of 466.49 g/mol. Its IUPAC name is 2-(2,2-difluoroethenyl)-1-fluoro-6-[2-fluoro-4-(2-fluoro-4-pentylphenyl)phenyl]naphthalene.
| Compound Name | 2-(2,2-difluoroethenyl)-1-fluoro-6-[2-fluoro-4-(2-fluoro-4-pentylphenyl)phenyl]naphthalene |
|---|---|
| PubChem CID | 139855966 |
| Molecular Formula | C29H23F5 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 2-(2,2-difluoroethenyl)-1-fluoro-6-[2-fluoro-4-(2-fluoro-4-pentylphenyl)phenyl]naphthalene |
| SMILES | CCCCCc1ccc(-c2ccc(-c3ccc4c(F)c(C=C(F)F)ccc4c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C29H23F5/c1-2-3-4-5-18-6-11-23(26(30)14-18)21-9-12-24(27(31)16-21)19-10-13-25-20(15-19)7-8-22(29(25)34)17-28(32)33/h6-17H,2-5H2,1H3 |
| InChIKey | ABGKFOTZWYGERE-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|