C20H24 — CID 159085021
2,7-dipropyl-9,10-dihydrophenanthrene (PubChem CID 159085021) has the molecular formula C20H24 and a molecular weight of 264.41 g/mol. Its IUPAC name is 2,7-dipropyl-9,10-dihydrophenanthrene.
| Compound Name | 2,7-dipropyl-9,10-dihydrophenanthrene |
|---|---|
| PubChem CID | 159085021 |
| Molecular Formula | C20H24 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | 2,7-dipropyl-9,10-dihydrophenanthrene |
| SMILES | CCCc1ccc2c(c1)CCc1cc(CCC)ccc1-2 |
| InChI | InChI=1S/C20H24/c1-3-5-15-7-11-19-17(13-15)9-10-18-14-16(6-4-2)8-12-20(18)19/h7-8,11-14H,3-6,9-10H2,1-2H3 |
| InChIKey | JPBQLKUSMVPIQJ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |