C27H36N2 — CID 172934411
(E)-N-[(E)-1-(7-octyl-9,10-dihydrophenanthren-2-yl)ethylideneamino]propan-2-imine (PubChem CID 172934411) has the molecular formula C27H36N2 and a molecular weight of 388.60 g/mol. Its IUPAC name is (E)-N-[(E)-1-(7-octyl-9,10-dihydrophenanthren-2-yl)ethylideneamino]propan-2-imine.
| Compound Name | (E)-N-[(E)-1-(7-octyl-9,10-dihydrophenanthren-2-yl)ethylideneamino]propan-2-imine |
|---|---|
| PubChem CID | 172934411 |
| Molecular Formula | C27H36N2 |
| Molecular Weight | 388.60 g/mol |
| Exact Mass | 388.29 |
| IUPAC Name | (E)-N-[(E)-1-(7-octyl-9,10-dihydrophenanthren-2-yl)ethylideneamino]propan-2-imine |
| SMILES | CCCCCCCCc1ccc2c(c1)CCc1cc(/C(C)=N/N=C(C)C)ccc1-2 |
| InChI | InChI=1S/C27H36N2/c1-5-6-7-8-9-10-11-22-12-16-26-24(18-22)13-14-25-19-23(15-17-27(25)26)21(4)29-28-20(2)3/h12,15-19H,5-11,13-14H2,1-4H3/b29-21+ |
| InChIKey | ZXUOVOHZUPFQSF-XHLNEMQHSA-N |
| XLogP | 7.56 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.60 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|