C14H19NO — CID 87785621
(NE)-N-(5-pentyl-2,3-dihydroinden-1-ylidene)hydroxylamine (PubChem CID 87785621) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is (NE)-N-(5-pentyl-2,3-dihydroinden-1-ylidene)hydroxylamine.
| Compound Name | (NE)-N-(5-pentyl-2,3-dihydroinden-1-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 87785621 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | (NE)-N-(5-pentyl-2,3-dihydroinden-1-ylidene)hydroxylamine |
| SMILES | CCCCCc1ccc2c(c1)CC/C2=N\O |
| InChI | InChI=1S/C14H19NO/c1-2-3-4-5-11-6-8-13-12(10-11)7-9-14(13)15-16/h6,8,10,16H,2-5,7,9H2,1H3/b15-14+ |
| InChIKey | KIENNIHXALWQLC-CCEZHUSRSA-N |
| XLogP | 3.54 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|