C11H13NO — CID 82074881
(NE)-N-(6-ethyl-2,3-dihydroinden-1-ylidene)hydroxylamine (PubChem CID 82074881) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is (NE)-N-(6-ethyl-2,3-dihydroinden-1-ylidene)hydroxylamine.
| Compound Name | (NE)-N-(6-ethyl-2,3-dihydroinden-1-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 82074881 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | (NE)-N-(6-ethyl-2,3-dihydroinden-1-ylidene)hydroxylamine |
| SMILES | CCc1ccc2c(c1)/C(=N/O)CC2 |
| InChI | InChI=1S/C11H13NO/c1-2-8-3-4-9-5-6-11(12-13)10(9)7-8/h3-4,7,13H,2,5-6H2,1H3/b12-11+ |
| InChIKey | WPERZPSQPMISGT-VAWYXSNFSA-N |
| XLogP | 2.37 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|