C13H18NORb — CID 145270202
ethane;7-ethyl-3,4-dihydroisoquinolin-2-id-1-one;rubidium(1+) (PubChem CID 145270202) has the molecular formula C13H18NORb and a molecular weight of 289.76 g/mol. Its IUPAC name is ethane;7-ethyl-3,4-dihydroisoquinolin-2-id-1-one;rubidium(1+).
| Compound Name | ethane;7-ethyl-3,4-dihydroisoquinolin-2-id-1-one;rubidium(1+) |
|---|---|
| PubChem CID | 145270202 |
| Molecular Formula | C13H18NORb |
| Molecular Weight | 289.76 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | ethane;7-ethyl-3,4-dihydroisoquinolin-2-id-1-one;rubidium(1+) |
| SMILES | CC.CCc1ccc2c(c1)C(=O)[N-]CC2.[Rb+] |
| InChI | InChI=1S/C11H13NO.C2H6.Rb/c1-2-8-3-4-9-5-6-12-11(13)10(9)7-8;1-2;/h3-4,7H,2,5-6H2,1H3,(H,12,13);1-2H3;/q;;+1/p-1 |
| InChIKey | CNJKPTVTNPUAJU-UHFFFAOYSA-M |
| XLogP | 0.35 |
| TPSA | 31.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.76 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |