C8H8N2O — CID 73297438
N-(5,6-dihydrocyclopenta[c]pyridin-7-ylidene)hydroxylamine (PubChem CID 73297438) has the molecular formula C8H8N2O and a molecular weight of 148.16 g/mol. Its IUPAC name is N-(5,6-dihydrocyclopenta[c]pyridin-7-ylidene)hydroxylamine.
| Compound Name | N-(5,6-dihydrocyclopenta[c]pyridin-7-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 73297438 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | N-(5,6-dihydrocyclopenta[c]pyridin-7-ylidene)hydroxylamine |
| SMILES | ON=C1CCc2ccncc21 |
| InChI | InChI=1S/C8H8N2O/c11-10-8-2-1-6-3-4-9-5-7(6)8/h3-5,11H,1-2H2 |
| InChIKey | MORALZJQOZZATP-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|