About N-(5,6-dihydrocyclopenta[c]pyridin-7-ylidene)hydroxylamine
N-(5,6-dihydrocyclopenta[c]pyridin-7-ylidene)hydroxylamine (PubChem CID 73297438) has the molecular formula C8H8N2O
and a molecular weight of 148.16 g/mol. Its IUPAC name is N-(5,6-dihydrocyclopenta[c]pyridin-7-ylidene)hydroxylamine.
Molecular Properties
| Compound Name | N-(5,6-dihydrocyclopenta[c]pyridin-7-ylidene)hydroxylamine |
| PubChem CID | 73297438 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | N-(5,6-dihydrocyclopenta[c]pyridin-7-ylidene)hydroxylamine |
| SMILES | ON=C1CCc2ccncc21 |
| InChI | InChI=1S/C8H8N2O/c11-10-8-2-1-6-3-4-9-5-7(6)8/h3-5,11H,1-2H2 |
| InChIKey | MORALZJQOZZATP-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(5,6-dihydrocyclopenta[c]pyridin-7-ylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5,6-dihydrocyclopenta[c]pyridin-7-ylidene)hydroxylamine?
The IUPAC name of N-(5,6-dihydrocyclopenta[c]pyridin-7-ylidene)hydroxylamine (CID 73297438) is N-(5,6-dihydrocyclopenta[c]pyridin-7-ylidene)hydroxylamine.
What is the SMILES notation for N-(5,6-dihydrocyclopenta[c]pyridin-7-ylidene)hydroxylamine?
The canonical SMILES for N-(5,6-dihydrocyclopenta[c]pyridin-7-ylidene)hydroxylamine is ON=C1CCc2ccncc21.
What is the InChIKey of N-(5,6-dihydrocyclopenta[c]pyridin-7-ylidene)hydroxylamine?
The InChIKey is MORALZJQOZZATP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O/c11-10-8-2-1-6-3-4-9-5-7(6)8/h3-5,11H,1-2H2.
What are the key properties of N-(5,6-dihydrocyclopenta[c]pyridin-7-ylidene)hydroxylamine?
N-(5,6-dihydrocyclopenta[c]pyridin-7-ylidene)hydroxylamine has a molecular weight of 148.16 g/mol, XLogP of 1.21, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5,6-dihydrocyclopenta[c]pyridin-7-ylidene)hydroxylamine is sourced from PubChem (CID 73297438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).