C7H7NOS — CID 18643667
(NZ)-N-(4,5-dihydrocyclopenta[b]thiophen-6-ylidene)hydroxylamine (PubChem CID 18643667) has the molecular formula C7H7NOS and a molecular weight of 153.21 g/mol. Its IUPAC name is (NZ)-N-(4,5-dihydrocyclopenta[b]thiophen-6-ylidene)hydroxylamine.
| Compound Name | (NZ)-N-(4,5-dihydrocyclopenta[b]thiophen-6-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 18643667 |
| Molecular Formula | C7H7NOS |
| Molecular Weight | 153.21 g/mol |
| Exact Mass | 153.02 |
| IUPAC Name | (NZ)-N-(4,5-dihydrocyclopenta[b]thiophen-6-ylidene)hydroxylamine |
| SMILES | O/N=C1/CCc2ccsc21 |
| InChI | InChI=1S/C7H7NOS/c9-8-6-2-1-5-3-4-10-7(5)6/h3-4,9H,1-2H2/b8-6- |
| InChIKey | GOLWSRVBSVLITK-VURMDHGXSA-N |
| XLogP | 1.87 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.21 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|