C7H8N2S — CID 18785787
4,5-dihydrothieno[2,3-c]pyridin-7-amine (PubChem CID 18785787) has the molecular formula C7H8N2S and a molecular weight of 152.22 g/mol. Its IUPAC name is 4,5-dihydrothieno[2,3-c]pyridin-7-amine.
| Compound Name | 4,5-dihydrothieno[2,3-c]pyridin-7-amine |
|---|---|
| PubChem CID | 18785787 |
| Molecular Formula | C7H8N2S |
| Molecular Weight | 152.22 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | 4,5-dihydrothieno[2,3-c]pyridin-7-amine |
| SMILES | NC1=NCCc2ccsc21 |
| InChI | InChI=1S/C7H8N2S/c8-7-6-5(1-3-9-7)2-4-10-6/h2,4H,1,3H2,(H2,8,9) |
| InChIKey | RDYWNZRVHKWADW-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.22 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |