About 4,5-dihydrothieno[3,2-d][1]benzoxepine-8-carboxamide
4,5-dihydrothieno[3,2-d][1]benzoxepine-8-carboxamide (PubChem CID 90691180) has the molecular formula C13H11NO2S
and a molecular weight of 245.30 g/mol. Its IUPAC name is 4,5-dihydrothieno[3,2-d][1]benzoxepine-8-carboxamide.
Molecular Properties
| Compound Name | 4,5-dihydrothieno[3,2-d][1]benzoxepine-8-carboxamide |
| PubChem CID | 90691180 |
| Molecular Formula | C13H11NO2S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 4,5-dihydrothieno[3,2-d][1]benzoxepine-8-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)OCCc1ccsc1-2 |
| InChI | InChI=1S/C13H11NO2S/c14-13(15)9-1-2-10-11(7-9)16-5-3-8-4-6-17-12(8)10/h1-2,4,6-7H,3,5H2,(H2,14,15) |
| InChIKey | ZMXSAVVRRFWRDR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5-dihydrothieno[3,2-d][1]benzoxepine-8-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydrothieno[3,2-d][1]benzoxepine-8-carboxamide?
The IUPAC name of 4,5-dihydrothieno[3,2-d][1]benzoxepine-8-carboxamide (CID 90691180) is 4,5-dihydrothieno[3,2-d][1]benzoxepine-8-carboxamide.
What is the SMILES notation for 4,5-dihydrothieno[3,2-d][1]benzoxepine-8-carboxamide?
The canonical SMILES for 4,5-dihydrothieno[3,2-d][1]benzoxepine-8-carboxamide is NC(=O)c1ccc2c(c1)OCCc1ccsc1-2.
What is the InChIKey of 4,5-dihydrothieno[3,2-d][1]benzoxepine-8-carboxamide?
The InChIKey is ZMXSAVVRRFWRDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO2S/c14-13(15)9-1-2-10-11(7-9)16-5-3-8-4-6-17-12(8)10/h1-2,4,6-7H,3,5H2,(H2,14,15).
What are the key properties of 4,5-dihydrothieno[3,2-d][1]benzoxepine-8-carboxamide?
4,5-dihydrothieno[3,2-d][1]benzoxepine-8-carboxamide has a molecular weight of 245.30 g/mol, XLogP of 2.45, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydrothieno[3,2-d][1]benzoxepine-8-carboxamide is sourced from PubChem (CID 90691180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).