C17H18BrIO3S2 — CID 176920179
ethane;2-iodosulfanylethyl 8-bromo-4,5-dihydrothieno[3,2-d][1]benzoxepine-9-carboxylate (PubChem CID 176920179) has the molecular formula C17H18BrIO3S2 and a molecular weight of 541.27 g/mol. Its IUPAC name is ethane;2-iodosulfanylethyl 8-bromo-4,5-dihydrothieno[3,2-d][1]benzoxepine-9-carboxylate.
| Compound Name | ethane;2-iodosulfanylethyl 8-bromo-4,5-dihydrothieno[3,2-d][1]benzoxepine-9-carboxylate |
|---|---|
| PubChem CID | 176920179 |
| Molecular Formula | C17H18BrIO3S2 |
| Molecular Weight | 541.27 g/mol |
| Exact Mass | 539.89 |
| IUPAC Name | ethane;2-iodosulfanylethyl 8-bromo-4,5-dihydrothieno[3,2-d][1]benzoxepine-9-carboxylate |
| SMILES | CC.O=C(OCCSI)c1cc2c(cc1Br)OCCc1ccsc1-2 |
| InChI | InChI=1S/C15H12BrIO3S2.C2H6/c16-12-8-13-11(7-10(12)15(18)20-4-6-22-17)14-9(1-3-19-13)2-5-21-14;1-2/h2,5,7-8H,1,3-4,6H2;1-2H3 |
| InChIKey | DJYBGOSTJMGDOD-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.27 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|