C27H27IN2O5S2 — CID 176920108
2-iodosulfanylethyl 8-[3-methanimidoyl-2-methoxycarbonyl-4-(propylamino)phenyl]-4,5-dihydrothieno[3,2-d][1]benzoxepine-9-carboxylate (PubChem CID 176920108) has the molecular formula C27H27IN2O5S2 and a molecular weight of 650.56 g/mol. Its IUPAC name is 2-iodosulfanylethyl 8-[3-methanimidoyl-2-methoxycarbonyl-4-(propylamino)phenyl]-4,5-dihydrothieno[3,2-d][1]benzoxepine-9-carboxylate.
| Compound Name | 2-iodosulfanylethyl 8-[3-methanimidoyl-2-methoxycarbonyl-4-(propylamino)phenyl]-4,5-dihydrothieno[3,2-d][1]benzoxepine-9-carboxylate |
|---|---|
| PubChem CID | 176920108 |
| Molecular Formula | C27H27IN2O5S2 |
| Molecular Weight | 650.56 g/mol |
| Exact Mass | 650.04 |
| IUPAC Name | 2-iodosulfanylethyl 8-[3-methanimidoyl-2-methoxycarbonyl-4-(propylamino)phenyl]-4,5-dihydrothieno[3,2-d][1]benzoxepine-9-carboxylate |
| SMILES | [H]/N=C/c1c(NCCC)ccc(-c2cc3c(cc2C(=O)OCCSI)-c2sccc2CCO3)c1C(=O)OC |
| InChI | InChI=1S/C27H27IN2O5S2/c1-3-8-30-22-5-4-17(24(21(22)15-29)27(32)33-2)18-14-23-20(13-19(18)26(31)35-10-12-37-28)25-16(6-9-34-23)7-11-36-25/h4-5,7,11,13-15,29-30H,3,6,8-10,12H2,1-2H3/b29-15+ |
| InChIKey | PQHOPWSXASPIFU-WKULSOCRSA-N |
| XLogP | 6.86 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.56 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|