C24H25IO5S2 — CID 176920631
2-iodosulfanylethyl 8-(2-ethoxycarbonylcyclohexen-1-yl)-4,5-dihydrothieno[3,2-d][1]benzoxepine-9-carboxylate (PubChem CID 176920631) has the molecular formula C24H25IO5S2 and a molecular weight of 584.50 g/mol. Its IUPAC name is 2-iodosulfanylethyl 8-(2-ethoxycarbonylcyclohexen-1-yl)-4,5-dihydrothieno[3,2-d][1]benzoxepine-9-carboxylate.
| Compound Name | 2-iodosulfanylethyl 8-(2-ethoxycarbonylcyclohexen-1-yl)-4,5-dihydrothieno[3,2-d][1]benzoxepine-9-carboxylate |
|---|---|
| PubChem CID | 176920631 |
| Molecular Formula | C24H25IO5S2 |
| Molecular Weight | 584.50 g/mol |
| Exact Mass | 584.02 |
| IUPAC Name | 2-iodosulfanylethyl 8-(2-ethoxycarbonylcyclohexen-1-yl)-4,5-dihydrothieno[3,2-d][1]benzoxepine-9-carboxylate |
| SMILES | CCOC(=O)C1=C(c2cc3c(cc2C(=O)OCCSI)-c2sccc2CCO3)CCCC1 |
| InChI | InChI=1S/C24H25IO5S2/c1-2-28-23(26)17-6-4-3-5-16(17)18-14-21-20(13-19(18)24(27)30-10-12-32-25)22-15(7-9-29-21)8-11-31-22/h8,11,13-14H,2-7,9-10,12H2,1H3 |
| InChIKey | XKSSKVQHEGDPEL-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.50 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|