C13H11BrN2S — CID 16731316
5-(3-bromophenyl)-4,5-dihydrothieno[2,3-c]pyridin-7-amine (PubChem CID 16731316) has the molecular formula C13H11BrN2S and a molecular weight of 307.22 g/mol. Its IUPAC name is 5-(3-bromophenyl)-4,5-dihydrothieno[2,3-c]pyridin-7-amine.
| Compound Name | 5-(3-bromophenyl)-4,5-dihydrothieno[2,3-c]pyridin-7-amine |
|---|---|
| PubChem CID | 16731316 |
| Molecular Formula | C13H11BrN2S |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 305.98 |
| IUPAC Name | 5-(3-bromophenyl)-4,5-dihydrothieno[2,3-c]pyridin-7-amine |
| SMILES | NC1=NC(c2cccc(Br)c2)Cc2ccsc21 |
| InChI | InChI=1S/C13H11BrN2S/c14-10-3-1-2-8(6-10)11-7-9-4-5-17-12(9)13(15)16-11/h1-6,11H,7H2,(H2,15,16) |
| InChIKey | WQCFHXSHHQDQIO-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |