About 5-(3-bromophenyl)-4,5-dihydrothieno[2,3-c]pyridin-7-amine
5-(3-bromophenyl)-4,5-dihydrothieno[2,3-c]pyridin-7-amine (PubChem CID 16731316) has the molecular formula C13H11BrN2S
and a molecular weight of 307.22 g/mol. Its IUPAC name is 5-(3-bromophenyl)-4,5-dihydrothieno[2,3-c]pyridin-7-amine.
Molecular Properties
| Compound Name | 5-(3-bromophenyl)-4,5-dihydrothieno[2,3-c]pyridin-7-amine |
| PubChem CID | 16731316 |
| Molecular Formula | C13H11BrN2S |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 305.98 |
| IUPAC Name | 5-(3-bromophenyl)-4,5-dihydrothieno[2,3-c]pyridin-7-amine |
| SMILES | NC1=NC(c2cccc(Br)c2)Cc2ccsc21 |
| InChI | InChI=1S/C13H11BrN2S/c14-10-3-1-2-8(6-10)11-7-9-4-5-17-12(9)13(15)16-11/h1-6,11H,7H2,(H2,15,16) |
| InChIKey | WQCFHXSHHQDQIO-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(3-bromophenyl)-4,5-dihydrothieno[2,3-c]pyridin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-bromophenyl)-4,5-dihydrothieno[2,3-c]pyridin-7-amine?
The IUPAC name of 5-(3-bromophenyl)-4,5-dihydrothieno[2,3-c]pyridin-7-amine (CID 16731316) is 5-(3-bromophenyl)-4,5-dihydrothieno[2,3-c]pyridin-7-amine.
What is the SMILES notation for 5-(3-bromophenyl)-4,5-dihydrothieno[2,3-c]pyridin-7-amine?
The canonical SMILES for 5-(3-bromophenyl)-4,5-dihydrothieno[2,3-c]pyridin-7-amine is NC1=NC(c2cccc(Br)c2)Cc2ccsc21.
What is the InChIKey of 5-(3-bromophenyl)-4,5-dihydrothieno[2,3-c]pyridin-7-amine?
The InChIKey is WQCFHXSHHQDQIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11BrN2S/c14-10-3-1-2-8(6-10)11-7-9-4-5-17-12(9)13(15)16-11/h1-6,11H,7H2,(H2,15,16).
What are the key properties of 5-(3-bromophenyl)-4,5-dihydrothieno[2,3-c]pyridin-7-amine?
5-(3-bromophenyl)-4,5-dihydrothieno[2,3-c]pyridin-7-amine has a molecular weight of 307.22 g/mol, XLogP of 3.51, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-bromophenyl)-4,5-dihydrothieno[2,3-c]pyridin-7-amine is sourced from PubChem (CID 16731316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).