C14H14ClN3 — CID 18785968
3-pyridin-3-yl-3,4-dihydroisoquinolin-1-amine;hydrochloride (PubChem CID 18785968) has the molecular formula C14H14ClN3 and a molecular weight of 259.74 g/mol. Its IUPAC name is 3-pyridin-3-yl-3,4-dihydroisoquinolin-1-amine;hydrochloride.
| Compound Name | 3-pyridin-3-yl-3,4-dihydroisoquinolin-1-amine;hydrochloride |
|---|---|
| PubChem CID | 18785968 |
| Molecular Formula | C14H14ClN3 |
| Molecular Weight | 259.74 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 3-pyridin-3-yl-3,4-dihydroisoquinolin-1-amine;hydrochloride |
| SMILES | Cl.NC1=NC(c2cccnc2)Cc2ccccc21 |
| InChI | InChI=1S/C14H13N3.ClH/c15-14-12-6-2-1-4-10(12)8-13(17-14)11-5-3-7-16-9-11;/h1-7,9,13H,8H2,(H2,15,17);1H |
| InChIKey | GHDZGHVLQVILRB-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.74 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |