C16H15NO — CID 11586733
3-methyl-2-pyridin-3-yl-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 11586733) has the molecular formula C16H15NO and a molecular weight of 237.30 g/mol. Its IUPAC name is 3-methyl-2-pyridin-3-yl-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 3-methyl-2-pyridin-3-yl-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 11586733 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 3-methyl-2-pyridin-3-yl-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | CC1Cc2ccccc2C(=O)C1c1cccnc1 |
| InChI | InChI=1S/C16H15NO/c1-11-9-12-5-2-3-7-14(12)16(18)15(11)13-6-4-8-17-10-13/h2-8,10-11,15H,9H2,1H3 |
| InChIKey | MXAILWRTXBPUAK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |