C12H13N — CID 166648131
3-(6-methylcyclohexa-2,4-dien-1-yl)pyridine (PubChem CID 166648131) has the molecular formula C12H13N and a molecular weight of 171.24 g/mol. Its IUPAC name is 3-(6-methylcyclohexa-2,4-dien-1-yl)pyridine.
| Compound Name | 3-(6-methylcyclohexa-2,4-dien-1-yl)pyridine |
|---|---|
| PubChem CID | 166648131 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 3-(6-methylcyclohexa-2,4-dien-1-yl)pyridine |
| SMILES | CC1C=CC=CC1c1cccnc1 |
| InChI | InChI=1S/C12H13N/c1-10-5-2-3-7-12(10)11-6-4-8-13-9-11/h2-10,12H,1H3 |
| InChIKey | GXWREDMJJDREGK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |