About (2S)-2-methyl-2,3-dihydroinden-1-one
(2S)-2-methyl-2,3-dihydroinden-1-one (PubChem CID 6994407) has the molecular formula C10H10O
and a molecular weight of 146.19 g/mol. Its IUPAC name is (2S)-2-methyl-2,3-dihydroinden-1-one.
Molecular Properties
| Compound Name | (2S)-2-methyl-2,3-dihydroinden-1-one |
| PubChem CID | 6994407 |
| Molecular Formula | C10H10O |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | (2S)-2-methyl-2,3-dihydroinden-1-one |
| SMILES | C[C@H]1Cc2ccccc2C1=O |
| InChI | InChI=1S/C10H10O/c1-7-6-8-4-2-3-5-9(8)10(7)11/h2-5,7H,6H2,1H3/t7-/m0/s1 |
| InChIKey | BEKNOGMQVKBMQN-ZETCQYMHSA-N |
| XLogP | 2.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S)-2-methyl-2,3-dihydroinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-methyl-2,3-dihydroinden-1-one?
The IUPAC name of (2S)-2-methyl-2,3-dihydroinden-1-one (CID 6994407) is (2S)-2-methyl-2,3-dihydroinden-1-one.
What is the SMILES notation for (2S)-2-methyl-2,3-dihydroinden-1-one?
The canonical SMILES for (2S)-2-methyl-2,3-dihydroinden-1-one is C[C@H]1Cc2ccccc2C1=O.
What is the InChIKey of (2S)-2-methyl-2,3-dihydroinden-1-one?
The InChIKey is BEKNOGMQVKBMQN-ZETCQYMHSA-N. The full InChI is InChI=1S/C10H10O/c1-7-6-8-4-2-3-5-9(8)10(7)11/h2-5,7H,6H2,1H3/t7-/m0/s1.
What are the key properties of (2S)-2-methyl-2,3-dihydroinden-1-one?
(2S)-2-methyl-2,3-dihydroinden-1-one has a molecular weight of 146.19 g/mol, XLogP of 2.06, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-methyl-2,3-dihydroinden-1-one is sourced from PubChem (CID 6994407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).