C10H8F2O — CID 122371695
2-(difluoromethyl)-2,3-dihydroinden-1-one (PubChem CID 122371695) has the molecular formula C10H8F2O and a molecular weight of 182.17 g/mol. Its IUPAC name is 2-(difluoromethyl)-2,3-dihydroinden-1-one.
| Compound Name | 2-(difluoromethyl)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 122371695 |
| Molecular Formula | C10H8F2O |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | 2-(difluoromethyl)-2,3-dihydroinden-1-one |
| SMILES | O=C1c2ccccc2CC1C(F)F |
| InChI | InChI=1S/C10H8F2O/c11-10(12)8-5-6-3-1-2-4-7(6)9(8)13/h1-4,8,10H,5H2 |
| InChIKey | SKPDESUJWFHBIU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |