About (4aS,9aR)-9a,10-dihydro-4aH-anthracen-9-one
(4aS,9aR)-9a,10-dihydro-4aH-anthracen-9-one (PubChem CID 7057091) has the molecular formula C14H12O
and a molecular weight of 196.25 g/mol. Its IUPAC name is (4aS,9aR)-9a,10-dihydro-4aH-anthracen-9-one.
Molecular Properties
| Compound Name | (4aS,9aR)-9a,10-dihydro-4aH-anthracen-9-one |
| PubChem CID | 7057091 |
| Molecular Formula | C14H12O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | (4aS,9aR)-9a,10-dihydro-4aH-anthracen-9-one |
| SMILES | O=C1c2ccccc2C[C@H]2C=CC=C[C@@H]12 |
| InChI | InChI=1S/C14H12O/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-8,10,12H,9H2/t10-,12-/m1/s1 |
| InChIKey | IOOPLVJTQNZFSP-ZYHUDNBSSA-N |
| XLogP | 2.78 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4aS,9aR)-9a,10-dihydro-4aH-anthracen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4aS,9aR)-9a,10-dihydro-4aH-anthracen-9-one?
The IUPAC name of (4aS,9aR)-9a,10-dihydro-4aH-anthracen-9-one (CID 7057091) is (4aS,9aR)-9a,10-dihydro-4aH-anthracen-9-one.
What is the SMILES notation for (4aS,9aR)-9a,10-dihydro-4aH-anthracen-9-one?
The canonical SMILES for (4aS,9aR)-9a,10-dihydro-4aH-anthracen-9-one is O=C1c2ccccc2C[C@H]2C=CC=C[C@@H]12.
What is the InChIKey of (4aS,9aR)-9a,10-dihydro-4aH-anthracen-9-one?
The InChIKey is IOOPLVJTQNZFSP-ZYHUDNBSSA-N. The full InChI is InChI=1S/C14H12O/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-8,10,12H,9H2/t10-,12-/m1/s1.
What are the key properties of (4aS,9aR)-9a,10-dihydro-4aH-anthracen-9-one?
(4aS,9aR)-9a,10-dihydro-4aH-anthracen-9-one has a molecular weight of 196.25 g/mol, XLogP of 2.78, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4aS,9aR)-9a,10-dihydro-4aH-anthracen-9-one is sourced from PubChem (CID 7057091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).