C13H15FO — CID 137380205
2-(1-fluorobutyl)-2,3-dihydroinden-1-one (PubChem CID 137380205) has the molecular formula C13H15FO and a molecular weight of 206.26 g/mol. Its IUPAC name is 2-(1-fluorobutyl)-2,3-dihydroinden-1-one.
| Compound Name | 2-(1-fluorobutyl)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 137380205 |
| Molecular Formula | C13H15FO |
| Molecular Weight | 206.26 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 2-(1-fluorobutyl)-2,3-dihydroinden-1-one |
| SMILES | CCCC(F)C1Cc2ccccc2C1=O |
| InChI | InChI=1S/C13H15FO/c1-2-5-12(14)11-8-9-6-3-4-7-10(9)13(11)15/h3-4,6-7,11-12H,2,5,8H2,1H3 |
| InChIKey | KEIWKDHWMWHOLH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.26 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |