C14H18O2S — CID 66655048
2-pentylsulfinyl-2,3-dihydroinden-1-one (PubChem CID 66655048) has the molecular formula C14H18O2S and a molecular weight of 250.36 g/mol. Its IUPAC name is 2-pentylsulfinyl-2,3-dihydroinden-1-one.
| Compound Name | 2-pentylsulfinyl-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 66655048 |
| Molecular Formula | C14H18O2S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 2-pentylsulfinyl-2,3-dihydroinden-1-one |
| SMILES | CCCCCS(=O)C1Cc2ccccc2C1=O |
| InChI | InChI=1S/C14H18O2S/c1-2-3-6-9-17(16)13-10-11-7-4-5-8-12(11)14(13)15/h4-5,7-8,13H,2-3,6,9-10H2,1H3 |
| InChIKey | RKULZTPSQXKVCM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|