C16H22O — CID 161415157
2-methyl-3-pentyl-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 161415157) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-methyl-3-pentyl-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 2-methyl-3-pentyl-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 161415157 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 2-methyl-3-pentyl-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | CCCCCC1Cc2ccccc2C(=O)C1C |
| InChI | InChI=1S/C16H22O/c1-3-4-5-8-13-11-14-9-6-7-10-15(14)16(17)12(13)2/h6-7,9-10,12-13H,3-5,8,11H2,1-2H3 |
| InChIKey | PJZXMBHNPONIEQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|