C14H19NO — CID 23389014
2-(5-aminopentyl)-2,3-dihydroinden-1-one (PubChem CID 23389014) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 2-(5-aminopentyl)-2,3-dihydroinden-1-one.
| Compound Name | 2-(5-aminopentyl)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 23389014 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 2-(5-aminopentyl)-2,3-dihydroinden-1-one |
| SMILES | NCCCCCC1Cc2ccccc2C1=O |
| InChI | InChI=1S/C14H19NO/c15-9-5-1-2-7-12-10-11-6-3-4-8-13(11)14(12)16/h3-4,6,8,12H,1-2,5,7,9-10,15H2 |
| InChIKey | ZMNUYYYZRAVOOQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|