C13H16O2 — CID 79429583
2-(3-hydroxypropyl)-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 79429583) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-(3-hydroxypropyl)-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 2-(3-hydroxypropyl)-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 79429583 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 2-(3-hydroxypropyl)-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | O=C1c2ccccc2CCC1CCCO |
| InChI | InChI=1S/C13H16O2/c14-9-3-5-11-8-7-10-4-1-2-6-12(10)13(11)15/h1-2,4,6,11,14H,3,5,7-9H2 |
| InChIKey | QIFYJJGIDKOVLL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |