C21H30O2 — CID 70527220
2-(6-oxoundecyl)-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 70527220) has the molecular formula C21H30O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is 2-(6-oxoundecyl)-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 2-(6-oxoundecyl)-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 70527220 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | 2-(6-oxoundecyl)-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | CCCCCC(=O)CCCCCC1CCc2ccccc2C1=O |
| InChI | InChI=1S/C21H30O2/c1-2-3-5-12-19(22)13-7-4-6-11-18-16-15-17-10-8-9-14-20(17)21(18)23/h8-10,14,18H,2-7,11-13,15-16H2,1H3 |
| InChIKey | PJNDCZMHRACPQP-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|