C17H19NO3 — CID 91165365
3-[2-(1-oxo-3,4-dihydro-2H-naphthalen-2-yl)ethyl]piperidine-2,6-dione (PubChem CID 91165365) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is 3-[2-(1-oxo-3,4-dihydro-2H-naphthalen-2-yl)ethyl]piperidine-2,6-dione.
| Compound Name | 3-[2-(1-oxo-3,4-dihydro-2H-naphthalen-2-yl)ethyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 91165365 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 3-[2-(1-oxo-3,4-dihydro-2H-naphthalen-2-yl)ethyl]piperidine-2,6-dione |
| SMILES | O=C1CCC(CCC2CCc3ccccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C17H19NO3/c19-15-10-9-13(17(21)18-15)8-7-12-6-5-11-3-1-2-4-14(11)16(12)20/h1-4,12-13H,5-10H2,(H,18,19,21) |
| InChIKey | VEHDHNZMHJAWEG-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|