C14H16N2OS — CID 88917642
(2S)-2-[(2-sulfanylideneimidazolidin-4-yl)methyl]-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 88917642) has the molecular formula C14H16N2OS and a molecular weight of 260.36 g/mol. Its IUPAC name is (2S)-2-[(2-sulfanylideneimidazolidin-4-yl)methyl]-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | (2S)-2-[(2-sulfanylideneimidazolidin-4-yl)methyl]-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 88917642 |
| Molecular Formula | C14H16N2OS |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | (2S)-2-[(2-sulfanylideneimidazolidin-4-yl)methyl]-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | O=C1c2ccccc2CC[C@H]1CC1CNC(=S)N1 |
| InChI | InChI=1S/C14H16N2OS/c17-13-10(7-11-8-15-14(18)16-11)6-5-9-3-1-2-4-12(9)13/h1-4,10-11H,5-8H2,(H2,15,16,18)/t10-,11?/m0/s1 |
| InChIKey | SOIZHXSEUSOISH-VUWPPUDQSA-N |
| XLogP | 1.67 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|