About 2-(cyclopropylmethyl)-3,4-dihydro-2H-naphthalen-1-one
2-(cyclopropylmethyl)-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 79429212) has the molecular formula C14H16O
and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-(cyclopropylmethyl)-3,4-dihydro-2H-naphthalen-1-one.
Analyze 2-(cyclopropylmethyl)-3,4-dihydro-2H-naphthalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclopropylmethyl)-3,4-dihydro-2H-naphthalen-1-one?
The IUPAC name of 2-(cyclopropylmethyl)-3,4-dihydro-2H-naphthalen-1-one (CID 79429212) is 2-(cyclopropylmethyl)-3,4-dihydro-2H-naphthalen-1-one.
What is the SMILES notation for 2-(cyclopropylmethyl)-3,4-dihydro-2H-naphthalen-1-one?
The canonical SMILES for 2-(cyclopropylmethyl)-3,4-dihydro-2H-naphthalen-1-one is O=C1c2ccccc2CCC1CC1CC1.
What is the InChIKey of 2-(cyclopropylmethyl)-3,4-dihydro-2H-naphthalen-1-one?
The InChIKey is VQVIGNPLOQDTRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O/c15-14-12(9-10-5-6-10)8-7-11-3-1-2-4-13(11)14/h1-4,10,12H,5-9H2.
What are the key properties of 2-(cyclopropylmethyl)-3,4-dihydro-2H-naphthalen-1-one?
2-(cyclopropylmethyl)-3,4-dihydro-2H-naphthalen-1-one has a molecular weight of 200.28 g/mol, XLogP of 3.23, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclopropylmethyl)-3,4-dihydro-2H-naphthalen-1-one is sourced from PubChem (CID 79429212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).