C17H17NO — CID 79429581
2-(2-pyridin-3-ylethyl)-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 79429581) has the molecular formula C17H17NO and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-(2-pyridin-3-ylethyl)-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 2-(2-pyridin-3-ylethyl)-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 79429581 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 2-(2-pyridin-3-ylethyl)-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | O=C1c2ccccc2CCC1CCc1cccnc1 |
| InChI | InChI=1S/C17H17NO/c19-17-15(8-7-13-4-3-11-18-12-13)10-9-14-5-1-2-6-16(14)17/h1-6,11-12,15H,7-10H2 |
| InChIKey | ICZBRGBKPLCELX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |