C9H7O3S- — CID 175105803
3-oxo-1,2-dihydroindene-2-sulfinate (PubChem CID 175105803) has the molecular formula C9H7O3S- and a molecular weight of 195.22 g/mol. Its IUPAC name is 3-oxo-1,2-dihydroindene-2-sulfinate.
| Compound Name | 3-oxo-1,2-dihydroindene-2-sulfinate |
|---|---|
| PubChem CID | 175105803 |
| Molecular Formula | C9H7O3S- |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.01 |
| IUPAC Name | 3-oxo-1,2-dihydroindene-2-sulfinate |
| SMILES | O=C1c2ccccc2CC1S(=O)[O-] |
| InChI | InChI=1S/C9H8O3S/c10-9-7-4-2-1-3-6(7)5-8(9)13(11)12/h1-4,8H,5H2,(H,11,12)/p-1 |
| InChIKey | YATKCERYAUUREN-UHFFFAOYSA-M |
| XLogP | 0.67 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|